C19H35NO5 — CID 67803869
[(2S,3R,4S,5R)-5-ethoxy-4-methoxy-2-non-1-enyloxan-3-yl] 2-aminoacetate (PubChem CID 67803869) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-5-ethoxy-4-methoxy-2-non-1-enyloxan-3-yl] 2-aminoacetate.
| Compound Name | [(2S,3R,4S,5R)-5-ethoxy-4-methoxy-2-non-1-enyloxan-3-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 67803869 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | [(2S,3R,4S,5R)-5-ethoxy-4-methoxy-2-non-1-enyloxan-3-yl] 2-aminoacetate |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@@H](OCC)[C@H](OC)[C@@H]1OC(=O)CN |
| InChI | InChI=1S/C19H35NO5/c1-4-6-7-8-9-10-11-12-15-19(25-17(21)13-20)18(22-3)16(14-24-15)23-5-2/h11-12,15-16,18-19H,4-10,13-14,20H2,1-3H3/t15-,16+,18-,19+/m0/s1 |
| InChIKey | ZXNWGPHFSIPMOA-OGWHTMIXSA-N |
| XLogP | 2.59 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|