C20H37NO4 — CID 67672328
[(2R,3S,4S)-4-methyl-6-[(Z)-non-1-enyl]-3-propoxyoxan-2-yl] 2-aminoacetate (PubChem CID 67672328) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is [(2R,3S,4S)-4-methyl-6-[(Z)-non-1-enyl]-3-propoxyoxan-2-yl] 2-aminoacetate.
| Compound Name | [(2R,3S,4S)-4-methyl-6-[(Z)-non-1-enyl]-3-propoxyoxan-2-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 67672328 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | [(2R,3S,4S)-4-methyl-6-[(Z)-non-1-enyl]-3-propoxyoxan-2-yl] 2-aminoacetate |
| SMILES | CCCCCCC/C=C\C1C[C@H](C)[C@H](OCCC)[C@@H](OC(=O)CN)O1 |
| InChI | InChI=1S/C20H37NO4/c1-4-6-7-8-9-10-11-12-17-14-16(3)19(23-13-5-2)20(24-17)25-18(22)15-21/h11-12,16-17,19-20H,4-10,13-15,21H2,1-3H3/b12-11-/t16-,17?,19-,20+/m0/s1 |
| InChIKey | RMQKRWUXVKSXAD-YLTPUGNASA-N |
| XLogP | 3.95 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|