C19H33NO5 — CID 67673523
[(6S,7S,10S)-10-methyl-7-non-1-enyl-1,4,8-trioxaspiro[4.5]decan-6-yl] 2-aminoacetate (PubChem CID 67673523) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is [(6S,7S,10S)-10-methyl-7-non-1-enyl-1,4,8-trioxaspiro[4.5]decan-6-yl] 2-aminoacetate.
| Compound Name | [(6S,7S,10S)-10-methyl-7-non-1-enyl-1,4,8-trioxaspiro[4.5]decan-6-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 67673523 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | [(6S,7S,10S)-10-methyl-7-non-1-enyl-1,4,8-trioxaspiro[4.5]decan-6-yl] 2-aminoacetate |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@H](C)C2(OCCO2)[C@H]1OC(=O)CN |
| InChI | InChI=1S/C19H33NO5/c1-3-4-5-6-7-8-9-10-16-18(25-17(21)13-20)19(15(2)14-22-16)23-11-12-24-19/h9-10,15-16,18H,3-8,11-14,20H2,1-2H3/t15-,16-,18-/m0/s1 |
| InChIKey | RJKTWCAHXCTVRU-BQFCYCMXSA-N |
| XLogP | 2.55 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|