C18H35NO2 — CID 67674235
(2S,3R,4S,5S)-4-methoxy-5-methyl-2-undec-1-enyloxan-3-amine (PubChem CID 67674235) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (2S,3R,4S,5S)-4-methoxy-5-methyl-2-undec-1-enyloxan-3-amine.
| Compound Name | (2S,3R,4S,5S)-4-methoxy-5-methyl-2-undec-1-enyloxan-3-amine |
|---|---|
| PubChem CID | 67674235 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (2S,3R,4S,5S)-4-methoxy-5-methyl-2-undec-1-enyloxan-3-amine |
| SMILES | CCCCCCCCCC=C[C@@H]1OC[C@H](C)[C@H](OC)[C@H]1N |
| InChI | InChI=1S/C18H35NO2/c1-4-5-6-7-8-9-10-11-12-13-16-17(19)18(20-3)15(2)14-21-16/h12-13,15-18H,4-11,14,19H2,1-3H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | FAODVSZZIABVJT-XSLAGTTESA-N |
| XLogP | 4.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|