C19H37NO3 — CID 67672410
(2S,3R,4R,5R)-5-butoxy-4-methoxy-2-non-1-enyloxan-3-amine (PubChem CID 67672410) has the molecular formula C19H37NO3 and a molecular weight of 327.51 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-non-1-enyloxan-3-amine.
| Compound Name | (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-non-1-enyloxan-3-amine |
|---|---|
| PubChem CID | 67672410 |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | (2S,3R,4R,5R)-5-butoxy-4-methoxy-2-non-1-enyloxan-3-amine |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@@H](OCCCC)[C@H](OC)[C@@H]1N |
| InChI | InChI=1S/C19H37NO3/c1-4-6-8-9-10-11-12-13-16-18(20)19(21-3)17(15-23-16)22-14-7-5-2/h12-13,16-19H,4-11,14-15,20H2,1-3H3/t16-,17+,18+,19-/m0/s1 |
| InChIKey | ASURTHYSHMANQC-MANSERQUSA-N |
| XLogP | 3.83 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|