About 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine
5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine (PubChem CID 142091973) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine.
Analyze 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine?
The IUPAC name of 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine (CID 142091973) is 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine.
What is the SMILES notation for 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine?
The canonical SMILES for 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine is C=CC1=C(C=C)OC(C)CO1.
What is the InChIKey of 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine?
The InChIKey is GUMBXDOIJTVBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-4-8-9(5-2)11-7(3)6-10-8/h4-5,7H,1-2,6H2,3H3.
What are the key properties of 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine?
5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine has a molecular weight of 152.19 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-2-methyl-2,3-dihydro-1,4-dioxine is sourced from PubChem (CID 142091973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).