C5H6O4 — CID 10329318
(5S)-5-methyl-1,4-dioxane-2,3-dione (PubChem CID 10329318) has the molecular formula C5H6O4 and a molecular weight of 130.10 g/mol. Its IUPAC name is (5S)-5-methyl-1,4-dioxane-2,3-dione.
| Compound Name | (5S)-5-methyl-1,4-dioxane-2,3-dione |
|---|---|
| PubChem CID | 10329318 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | (5S)-5-methyl-1,4-dioxane-2,3-dione |
| SMILES | C[C@H]1COC(=O)C(=O)O1 |
| InChI | InChI=1S/C5H6O4/c1-3-2-8-4(6)5(7)9-3/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | GVBOBOKIWHDTAH-VKHMYHEASA-N |
| XLogP | -0.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|