C11H18O — CID 144691925
4,5-bis(ethenyl)-2-methyl-2,3-dihydrofuran;ethane (PubChem CID 144691925) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-methyl-2,3-dihydrofuran;ethane.
| Compound Name | 4,5-bis(ethenyl)-2-methyl-2,3-dihydrofuran;ethane |
|---|---|
| PubChem CID | 144691925 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4,5-bis(ethenyl)-2-methyl-2,3-dihydrofuran;ethane |
| SMILES | C=CC1=C(C=C)OC(C)C1.CC |
| InChI | InChI=1S/C9H12O.C2H6/c1-4-8-6-7(3)10-9(8)5-2;1-2/h4-5,7H,1-2,6H2,3H3;1-2H3 |
| InChIKey | AMNBTEJPXIHWGT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |