C13H25N — CID 144962467
4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine;ethane (PubChem CID 144962467) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine;ethane.
| Compound Name | 4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine;ethane |
|---|---|
| PubChem CID | 144962467 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 4,5-bis(ethenyl)-1,2,3,6-tetrahydropyridine;ethane |
| SMILES | C=CC1=C(C=C)CNCC1.CC.CC |
| InChI | InChI=1S/C9H13N.2C2H6/c1-3-8-5-6-10-7-9(8)4-2;2*1-2/h3-4,10H,1-2,5-7H2;2*1-2H3 |
| InChIKey | SWFOGKNSNFJPQQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |