About N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine
N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine (PubChem CID 174266215) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine.
Analyze N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The IUPAC name of N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine (CID 174266215) is N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine.
What is the SMILES notation for N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The canonical SMILES for N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine is C=CNC1=C(C)CCNC1.
What is the InChIKey of N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
The InChIKey is VRPOWRFIKHBZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-10-8-6-9-5-4-7(8)2/h3,9-10H,1,4-6H2,2H3.
What are the key properties of N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine?
N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine has a molecular weight of 138.21 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4-methyl-1,2,3,6-tetrahydropyridin-5-amine is sourced from PubChem (CID 174266215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).