C9H13N — CID 143015528
N-ethenyl-4-methylcyclohexa-1,3-dien-1-amine (PubChem CID 143015528) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is N-ethenyl-4-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | N-ethenyl-4-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143015528 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-ethenyl-4-methylcyclohexa-1,3-dien-1-amine |
| SMILES | C=CNC1=CC=C(C)CC1 |
| InChI | InChI=1S/C9H13N/c1-3-10-9-6-4-8(2)5-7-9/h3-4,6,10H,1,5,7H2,2H3 |
| InChIKey | GYEAEQRBLACWBZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |