C8H12N2 — CID 142065982
5,6-bis(ethenyl)-1,2,3,4-tetrahydropyrimidine (PubChem CID 142065982) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-1,2,3,4-tetrahydropyrimidine.
| Compound Name | 5,6-bis(ethenyl)-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 142065982 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5,6-bis(ethenyl)-1,2,3,4-tetrahydropyrimidine |
| SMILES | C=CC1=C(C=C)NCNC1 |
| InChI | InChI=1S/C8H12N2/c1-3-7-5-9-6-10-8(7)4-2/h3-4,9-10H,1-2,5-6H2 |
| InChIKey | ZYJCRJDWVKWMDH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |