C7H10N2O — CID 164919011
N-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)methanimine (PubChem CID 164919011) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is N-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)methanimine.
| Compound Name | N-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)methanimine |
|---|---|
| PubChem CID | 164919011 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)methanimine |
| SMILES | C=CC1=C(N=C)OCCN1 |
| InChI | InChI=1S/C7H10N2O/c1-3-6-7(8-2)10-5-4-9-6/h3,9H,1-2,4-5H2 |
| InChIKey | ULPGFBAGBQJICE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|