About (2E)-2-benzylidene-1,3-oxazolidine
(2E)-2-benzylidene-1,3-oxazolidine (PubChem CID 102070685) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is (2E)-2-benzylidene-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2E)-2-benzylidene-1,3-oxazolidine |
| PubChem CID | 102070685 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (2E)-2-benzylidene-1,3-oxazolidine |
| SMILES | C(=C1\NCCO1)\c1ccccc1 |
| InChI | InChI=1S/C10H11NO/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5,8,11H,6-7H2/b10-8+ |
| InChIKey | QDSZTUZNJLMZQM-CSKARUKUSA-N |
| XLogP | 1.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-benzylidene-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-benzylidene-1,3-oxazolidine?
The IUPAC name of (2E)-2-benzylidene-1,3-oxazolidine (CID 102070685) is (2E)-2-benzylidene-1,3-oxazolidine.
What is the SMILES notation for (2E)-2-benzylidene-1,3-oxazolidine?
The canonical SMILES for (2E)-2-benzylidene-1,3-oxazolidine is C(=C1\NCCO1)\c1ccccc1.
What is the InChIKey of (2E)-2-benzylidene-1,3-oxazolidine?
The InChIKey is QDSZTUZNJLMZQM-CSKARUKUSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5,8,11H,6-7H2/b10-8+.
What are the key properties of (2E)-2-benzylidene-1,3-oxazolidine?
(2E)-2-benzylidene-1,3-oxazolidine has a molecular weight of 161.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-benzylidene-1,3-oxazolidine is sourced from PubChem (CID 102070685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).