C19H19N — CID 5474874
(3Z,5Z)-3,5-dibenzylidenepiperidine (PubChem CID 5474874) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is (3Z,5Z)-3,5-dibenzylidenepiperidine.
| Compound Name | (3Z,5Z)-3,5-dibenzylidenepiperidine |
|---|---|
| PubChem CID | 5474874 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (3Z,5Z)-3,5-dibenzylidenepiperidine |
| SMILES | C(=C1\CNC/C(=C\c2ccccc2)C1)\c1ccccc1 |
| InChI | InChI=1S/C19H19N/c1-3-7-16(8-4-1)11-18-13-19(15-20-14-18)12-17-9-5-2-6-10-17/h1-12,20H,13-15H2/b18-11-,19-12- |
| InChIKey | VJVSOFFOHNGRHQ-ZAORYEFMSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |