C8H14N2O — CID 174864326
2-(pyrrolidin-1-ylmethylidene)-1,3-oxazolidine (PubChem CID 174864326) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(pyrrolidin-1-ylmethylidene)-1,3-oxazolidine.
| Compound Name | 2-(pyrrolidin-1-ylmethylidene)-1,3-oxazolidine |
|---|---|
| PubChem CID | 174864326 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-(pyrrolidin-1-ylmethylidene)-1,3-oxazolidine |
| SMILES | C(=C1NCCO1)N1CCCC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-5-10(4-1)7-8-9-3-6-11-8/h7,9H,1-6H2 |
| InChIKey | SLCXJXDYFQIMLU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |