C18H15NO2 — CID 166445870
(3R,3'E)-3'-benzylidenespiro[2H-isoindole-3,2'-oxolane]-1-one (PubChem CID 166445870) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R,3'E)-3'-benzylidenespiro[2H-isoindole-3,2'-oxolane]-1-one.
| Compound Name | (3R,3'E)-3'-benzylidenespiro[2H-isoindole-3,2'-oxolane]-1-one |
|---|---|
| PubChem CID | 166445870 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3R,3'E)-3'-benzylidenespiro[2H-isoindole-3,2'-oxolane]-1-one |
| SMILES | O=C1N[C@]2(OCC/C2=C\c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H15NO2/c20-17-15-8-4-5-9-16(15)18(19-17)14(10-11-21-18)12-13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,19,20)/b14-12+/t18-/m1/s1 |
| InChIKey | MSMDPCOCJUQZAG-QIXNEVBVSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |