C22H14INO — CID 139095295
(3R)-2'-iodo-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 139095295) has the molecular formula C22H14INO and a molecular weight of 435.26 g/mol. Its IUPAC name is (3R)-2'-iodo-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | (3R)-2'-iodo-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 139095295 |
| Molecular Formula | C22H14INO |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | (3R)-2'-iodo-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | O=C1N[C@@]2(C(I)=C(c3ccccc3)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C22H14INO/c23-20-19(14-8-2-1-3-9-14)15-10-4-6-12-17(15)22(20)18-13-7-5-11-16(18)21(25)24-22/h1-13H,(H,24,25)/t22-/m1/s1 |
| InChIKey | NRPXXTDKDZWCAJ-JOCHJYFZSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|