C16H11NO — CID 172685945
spiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 172685945) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is spiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | spiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 172685945 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | spiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | O=C1NC2(C=Cc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C16H11NO/c18-15-12-6-2-4-8-14(12)16(17-15)10-9-11-5-1-3-7-13(11)16/h1-10H,(H,17,18) |
| InChIKey | BAQLHDOOROOTGQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |