About spiro[2H-isoindole-3,1'-indene]-1-one
spiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 172685945) has the molecular formula C16H11NO
and a molecular weight of 233.27 g/mol. Its IUPAC name is spiro[2H-isoindole-3,1'-indene]-1-one.
Molecular Properties
| Compound Name | spiro[2H-isoindole-3,1'-indene]-1-one |
| PubChem CID | 172685945 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | spiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | O=C1NC2(C=Cc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C16H11NO/c18-15-12-6-2-4-8-14(12)16(17-15)10-9-11-5-1-3-7-13(11)16/h1-10H,(H,17,18) |
| InChIKey | BAQLHDOOROOTGQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2H-isoindole-3,1'-indene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2H-isoindole-3,1'-indene]-1-one?
The IUPAC name of spiro[2H-isoindole-3,1'-indene]-1-one (CID 172685945) is spiro[2H-isoindole-3,1'-indene]-1-one.
What is the SMILES notation for spiro[2H-isoindole-3,1'-indene]-1-one?
The canonical SMILES for spiro[2H-isoindole-3,1'-indene]-1-one is O=C1NC2(C=Cc3ccccc32)c2ccccc21.
What is the InChIKey of spiro[2H-isoindole-3,1'-indene]-1-one?
The InChIKey is BAQLHDOOROOTGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO/c18-15-12-6-2-4-8-14(12)16(17-15)10-9-11-5-1-3-7-13(11)16/h1-10H,(H,17,18).
What are the key properties of spiro[2H-isoindole-3,1'-indene]-1-one?
spiro[2H-isoindole-3,1'-indene]-1-one has a molecular weight of 233.27 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2H-isoindole-3,1'-indene]-1-one is sourced from PubChem (CID 172685945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).