C12H15NO2 — CID 58979741
3-tert-butyl-3-deuteriooxy-2H-isoindol-1-one (PubChem CID 58979741) has the molecular formula C12H15NO2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-tert-butyl-3-deuteriooxy-2H-isoindol-1-one.
| Compound Name | 3-tert-butyl-3-deuteriooxy-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58979741 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-tert-butyl-3-deuteriooxy-2H-isoindol-1-one |
| SMILES | [2H]OC1(C(C)(C)C)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C12H15NO2/c1-11(2,3)12(15)9-7-5-4-6-8(9)10(14)13-12/h4-7,15H,1-3H3,(H,13,14)/i15D |
| InChIKey | SJCRLVPFNGRUFQ-RWFJLFJASA-N |
| XLogP | 1.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |