C11H10N2O2 — CID 170518385
spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione (PubChem CID 170518385) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione.
| Compound Name | spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
|---|---|
| PubChem CID | 170518385 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
| SMILES | O=C1NC2(CCNC2=O)c2ccccc21 |
| InChI | InChI=1S/C11H10N2O2/c14-9-7-3-1-2-4-8(7)11(13-9)5-6-12-10(11)15/h1-4H,5-6H2,(H,12,15)(H,13,14) |
| InChIKey | PQARVMNJBQHYAH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |