About spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione
spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione (PubChem CID 170518385) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione.
Molecular Properties
| Compound Name | spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
| PubChem CID | 170518385 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione |
| SMILES | O=C1NC2(CCNC2=O)c2ccccc21 |
| InChI | InChI=1S/C11H10N2O2/c14-9-7-3-1-2-4-8(7)11(13-9)5-6-12-10(11)15/h1-4H,5-6H2,(H,12,15)(H,13,14) |
| InChIKey | PQARVMNJBQHYAH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione?
The IUPAC name of spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione (CID 170518385) is spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione.
What is the SMILES notation for spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione?
The canonical SMILES for spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione is O=C1NC2(CCNC2=O)c2ccccc21.
What is the InChIKey of spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione?
The InChIKey is PQARVMNJBQHYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-9-7-3-1-2-4-8(7)11(13-9)5-6-12-10(11)15/h1-4H,5-6H2,(H,12,15)(H,13,14).
What are the key properties of spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione?
spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione has a molecular weight of 202.21 g/mol, XLogP of 0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2H-isoindole-3,3'-pyrrolidine]-1,2'-dione is sourced from PubChem (CID 170518385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).