C22H15NO5 — CID 171573692
2-[3-(1,3-dioxoinden-2-yl)-2-oxopyrrolidin-3-yl]indene-1,3-dione (PubChem CID 171573692) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoinden-2-yl)-2-oxopyrrolidin-3-yl]indene-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxoinden-2-yl)-2-oxopyrrolidin-3-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 171573692 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[3-(1,3-dioxoinden-2-yl)-2-oxopyrrolidin-3-yl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C1(C2C(=O)c3ccccc3C2=O)CCNC1=O |
| InChI | InChI=1S/C22H15NO5/c24-17-11-5-1-2-6-12(11)18(25)15(17)22(9-10-23-21(22)28)16-19(26)13-7-3-4-8-14(13)20(16)27/h1-8,15-16H,9-10H2,(H,23,28) |
| InChIKey | DQTGQYMUMHSQGS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|