C16H16O4 — CID 175452386
1-(1,3-dioxoinden-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 175452386) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(1,3-dioxoinden-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(1,3-dioxoinden-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 175452386 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(1,3-dioxoinden-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C1c2ccccc2C(=O)C1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C16H16O4/c17-13-10-6-2-3-7-11(10)14(18)12(13)16(15(19)20)8-4-1-5-9-16/h2-3,6-7,12H,1,4-5,8-9H2,(H,19,20) |
| InChIKey | VZUACAPGHIUUSL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|