C15H16O4 — CID 16745307
1-oxospiro[4H-isochromene-3,1'-cyclohexane]-4-carboxylic acid (PubChem CID 16745307) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-oxospiro[4H-isochromene-3,1'-cyclohexane]-4-carboxylic acid.
| Compound Name | 1-oxospiro[4H-isochromene-3,1'-cyclohexane]-4-carboxylic acid |
|---|---|
| PubChem CID | 16745307 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-oxospiro[4H-isochromene-3,1'-cyclohexane]-4-carboxylic acid |
| SMILES | O=C1OC2(CCCCC2)C(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C15H16O4/c16-13(17)12-10-6-2-3-7-11(10)14(18)19-15(12)8-4-1-5-9-15/h2-3,6-7,12H,1,4-5,8-9H2,(H,16,17) |
| InChIKey | KLMOQJHTFWLQCH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |