C23H13F3INO — CID 141452528
2'-iodo-3'-phenyl-5-(trifluoromethyl)spiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 141452528) has the molecular formula C23H13F3INO and a molecular weight of 503.26 g/mol. Its IUPAC name is 2'-iodo-3'-phenyl-5-(trifluoromethyl)spiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | 2'-iodo-3'-phenyl-5-(trifluoromethyl)spiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 141452528 |
| Molecular Formula | C23H13F3INO |
| Molecular Weight | 503.26 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | 2'-iodo-3'-phenyl-5-(trifluoromethyl)spiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | O=C1NC2(C(I)=C(c3ccccc3)c3ccccc32)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H13F3INO/c24-23(25,26)14-10-11-16-18(12-14)22(28-21(16)29)17-9-5-4-8-15(17)19(20(22)27)13-6-2-1-3-7-13/h1-12H,(H,28,29) |
| InChIKey | TWEOAZDPELDJHS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|