C10H14N2O — CID 167072784
(1E)-1-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)buta-1,3-dien-1-amine (PubChem CID 167072784) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (1E)-1-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-1-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167072784 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (1E)-1-(5-ethenyl-3,4-dihydro-2H-1,4-oxazin-6-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/N)C1=C(C=C)NCCO1 |
| InChI | InChI=1S/C10H14N2O/c1-3-5-8(11)10-9(4-2)12-6-7-13-10/h3-5,12H,1-2,6-7,11H2/b8-5+ |
| InChIKey | HKGZBOLIIPJAGW-VMPITWQZSA-N |
| XLogP | 1.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|