About 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine
6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine (PubChem CID 153340913) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine.
Analyze 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine?
The IUPAC name of 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine (CID 153340913) is 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine?
The canonical SMILES for 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine is C=CC1=C(C(=C)C)CCCN1.
What is the InChIKey of 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine?
The InChIKey is CCRLNSWDNUEIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-4-10-9(8(2)3)6-5-7-11-10/h4,11H,1-2,5-7H2,3H3.
What are the key properties of 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine?
6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine has a molecular weight of 149.24 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-5-prop-1-en-2-yl-1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 153340913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).