C13H23NO6 — CID 22153662
ethenyl 2-methylprop-2-enoate;propane-1,2,3-triol;pyrrolidin-2-one (PubChem CID 22153662) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethenyl 2-methylprop-2-enoate;propane-1,2,3-triol;pyrrolidin-2-one.
| Compound Name | ethenyl 2-methylprop-2-enoate;propane-1,2,3-triol;pyrrolidin-2-one |
|---|---|
| PubChem CID | 22153662 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | ethenyl 2-methylprop-2-enoate;propane-1,2,3-triol;pyrrolidin-2-one |
| SMILES | C=COC(=O)C(=C)C.O=C1CCCN1.OCC(O)CO |
| InChI | InChI=1S/C6H8O2.C4H7NO.C3H8O3/c1-4-8-6(7)5(2)3;6-4-2-1-3-5-4;4-1-3(6)2-5/h4H,1-2H2,3H3;1-3H2,(H,5,6);3-6H,1-2H2 |
| InChIKey | YBDIQKPERWQSHK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|