About 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one (PubChem CID 160933786) has the molecular formula C13H29NO8
and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one |
| PubChem CID | 160933786 |
| Molecular Formula | C13H29NO8 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one |
| SMILES | O=C1CCCN1.OCC(O)CO.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C4H7NO.C3H8O3/c7-1-3-9-5-6-10-4-2-8;6-4-2-1-3-5-4;4-1-3(6)2-5/h7-8H,1-6H2;1-3H2,(H,5,6);3-6H,1-2H2 |
| InChIKey | STPMNGVCDQMQKN-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one (CID 160933786) is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one is O=C1CCCN1.OCC(O)CO.OCCOCCOCCO.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one?
The InChIKey is STPMNGVCDQMQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4.C4H7NO.C3H8O3/c7-1-3-9-5-6-10-4-2-8;6-4-2-1-3-5-4;4-1-3(6)2-5/h7-8H,1-6H2;1-3H2,(H,5,6);3-6H,1-2H2.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one?
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one has a molecular weight of 327.37 g/mol, XLogP of -2.77, 9 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;propane-1,2,3-triol;pyrrolidin-2-one is sourced from PubChem (CID 160933786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).