About (1Z)-1-phosphanylbuta-1,3-dien-1-amine
(1Z)-1-phosphanylbuta-1,3-dien-1-amine (PubChem CID 100934666) has the molecular formula C4H8NP
and a molecular weight of 101.09 g/mol. Its IUPAC name is (1Z)-1-phosphanylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-1-phosphanylbuta-1,3-dien-1-amine |
| PubChem CID | 100934666 |
| Molecular Formula | C4H8NP |
| Molecular Weight | 101.09 g/mol |
| Exact Mass | 101.04 |
| IUPAC Name | (1Z)-1-phosphanylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/N)P |
| InChI | InChI=1S/C4H8NP/c1-2-3-4(5)6/h2-3H,1,5-6H2/b4-3- |
| InChIKey | ZWIVITUKLPGVPQ-ARJAWSKDSA-N |
| XLogP | 0.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.09 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-phosphanylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-phosphanylbuta-1,3-dien-1-amine?
The IUPAC name of (1Z)-1-phosphanylbuta-1,3-dien-1-amine (CID 100934666) is (1Z)-1-phosphanylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1Z)-1-phosphanylbuta-1,3-dien-1-amine?
The canonical SMILES for (1Z)-1-phosphanylbuta-1,3-dien-1-amine is C=C/C=C(/N)P.
What is the InChIKey of (1Z)-1-phosphanylbuta-1,3-dien-1-amine?
The InChIKey is ZWIVITUKLPGVPQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H8NP/c1-2-3-4(5)6/h2-3H,1,5-6H2/b4-3-.
What are the key properties of (1Z)-1-phosphanylbuta-1,3-dien-1-amine?
(1Z)-1-phosphanylbuta-1,3-dien-1-amine has a molecular weight of 101.09 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-phosphanylbuta-1,3-dien-1-amine is sourced from PubChem (CID 100934666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).