C4H8NP — CID 100934666
(1Z)-1-phosphanylbuta-1,3-dien-1-amine (PubChem CID 100934666) has the molecular formula C4H8NP and a molecular weight of 101.09 g/mol. Its IUPAC name is (1Z)-1-phosphanylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-1-phosphanylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 100934666 |
| Molecular Formula | C4H8NP |
| Molecular Weight | 101.09 g/mol |
| Exact Mass | 101.04 |
| IUPAC Name | (1Z)-1-phosphanylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/N)P |
| InChI | InChI=1S/C4H8NP/c1-2-3-4(5)6/h2-3H,1,5-6H2/b4-3- |
| InChIKey | ZWIVITUKLPGVPQ-ARJAWSKDSA-N |
| XLogP | 0.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.09 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|