C5H8NP — CID 135159127
(2E)-1-phosphanylidenepenta-2,4-dien-2-amine (PubChem CID 135159127) has the molecular formula C5H8NP and a molecular weight of 113.10 g/mol. Its IUPAC name is (2E)-1-phosphanylidenepenta-2,4-dien-2-amine.
| Compound Name | (2E)-1-phosphanylidenepenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 135159127 |
| Molecular Formula | C5H8NP |
| Molecular Weight | 113.10 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | (2E)-1-phosphanylidenepenta-2,4-dien-2-amine |
| SMILES | [H]/P=C/C(N)=C\C=C |
| InChI | InChI=1S/C5H8NP/c1-2-3-5(6)4-7/h2-4,7H,1,6H2/b5-3+ |
| InChIKey | NEJRDNQVNFYSPL-HWKANZROSA-N |
| XLogP | 0.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.10 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|