C6H8ClN — CID 156824437
(3E)-2-chlorohexa-1,3,5-trien-3-amine (PubChem CID 156824437) has the molecular formula C6H8ClN and a molecular weight of 129.59 g/mol. Its IUPAC name is (3E)-2-chlorohexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-2-chlorohexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156824437 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | (3E)-2-chlorohexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/N)C(=C)Cl |
| InChI | InChI=1S/C6H8ClN/c1-3-4-6(8)5(2)7/h3-4H,1-2,8H2/b6-4+ |
| InChIKey | NYKMKTZDJRBMRG-GQCTYLIASA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|