About 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane
2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane (PubChem CID 168899023) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane |
| PubChem CID | 168899023 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane |
| SMILES | C=CC1=C(C=C)OCCCO1.CC.CC |
| InChI | InChI=1S/C9H12O2.2C2H6/c1-3-8-9(4-2)11-7-5-6-10-8;2*1-2/h3-4H,1-2,5-7H2;2*1-2H3 |
| InChIKey | GHJZLMHECRYULD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane?
The IUPAC name of 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane (CID 168899023) is 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane.
What is the SMILES notation for 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane?
The canonical SMILES for 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane is C=CC1=C(C=C)OCCCO1.CC.CC.
What is the InChIKey of 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane?
The InChIKey is GHJZLMHECRYULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.2C2H6/c1-3-8-9(4-2)11-7-5-6-10-8;2*1-2/h3-4H,1-2,5-7H2;2*1-2H3.
What are the key properties of 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane?
2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane has a molecular weight of 212.33 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane is sourced from PubChem (CID 168899023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).