C13H24O2 — CID 168899023
2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane (PubChem CID 168899023) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane.
| Compound Name | 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane |
|---|---|
| PubChem CID | 168899023 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,3-bis(ethenyl)-6,7-dihydro-5H-1,4-dioxepine;ethane |
| SMILES | C=CC1=C(C=C)OCCCO1.CC.CC |
| InChI | InChI=1S/C9H12O2.2C2H6/c1-3-8-9(4-2)11-7-5-6-10-8;2*1-2/h3-4H,1-2,5-7H2;2*1-2H3 |
| InChIKey | GHJZLMHECRYULD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |