About 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine
5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine (PubChem CID 143157637) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine.
Analyze 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine?
The IUPAC name of 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine (CID 143157637) is 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine is C=CC1=C(C=C)N(C)CCO1.
What is the InChIKey of 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine?
The InChIKey is XDNVSACWZNHPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-4-8-9(5-2)11-7-6-10(8)3/h4-5H,1-2,6-7H2,3H3.
What are the key properties of 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine?
5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine has a molecular weight of 151.21 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 143157637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).