C10H10NOY- — CID 58541108
4-ethenyl-3,7-dihydro-2H-1,4-benzoxazin-7-ide;yttrium (PubChem CID 58541108) has the molecular formula C10H10NOY- and a molecular weight of 249.10 g/mol. Its IUPAC name is 4-ethenyl-3,7-dihydro-2H-1,4-benzoxazin-7-ide;yttrium.
| Compound Name | 4-ethenyl-3,7-dihydro-2H-1,4-benzoxazin-7-ide;yttrium |
|---|---|
| PubChem CID | 58541108 |
| Molecular Formula | C10H10NOY- |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 4-ethenyl-3,7-dihydro-2H-1,4-benzoxazin-7-ide;yttrium |
| SMILES | C=CN1CCOc2c[c-]ccc21.[Y] |
| InChI | InChI=1S/C10H10NO.Y/c1-2-11-7-8-12-10-6-4-3-5-9(10)11;/h2-3,5-6H,1,7-8H2;/q-1; |
| InChIKey | FJURZEQPSHPJNU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|