C8H8NOY- — CID 156809952
2,3,4,7-tetrahydro-1,4-benzoxazin-7-ide;yttrium (PubChem CID 156809952) has the molecular formula C8H8NOY- and a molecular weight of 223.06 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-1,4-benzoxazin-7-ide;yttrium.
| Compound Name | 2,3,4,7-tetrahydro-1,4-benzoxazin-7-ide;yttrium |
|---|---|
| PubChem CID | 156809952 |
| Molecular Formula | C8H8NOY- |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2,3,4,7-tetrahydro-1,4-benzoxazin-7-ide;yttrium |
| SMILES | [Y].[c-]1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C8H8NO.Y/c1-2-4-8-7(3-1)9-5-6-10-8;/h1,3-4,9H,5-6H2;/q-1; |
| InChIKey | UHDUPCVTWNCMRS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|