C8H8N2O — CID 87863813
5H-pyrano[3,2-b]pyridin-4-amine (PubChem CID 87863813) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 5H-pyrano[3,2-b]pyridin-4-amine.
| Compound Name | 5H-pyrano[3,2-b]pyridin-4-amine |
|---|---|
| PubChem CID | 87863813 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5H-pyrano[3,2-b]pyridin-4-amine |
| SMILES | NC1=C2NC=CC=C2OC=C1 |
| InChI | InChI=1S/C8H8N2O/c9-6-3-5-11-7-2-1-4-10-8(6)7/h1-5,10H,9H2 |
| InChIKey | MWKONYHWSKLVJC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |