C9H13NO — CID 142054832
(2E)-2-[(Z)-but-2-enylidene]-3-methylidenemorpholine (PubChem CID 142054832) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-3-methylidenemorpholine.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-3-methylidenemorpholine |
|---|---|
| PubChem CID | 142054832 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-3-methylidenemorpholine |
| SMILES | C=C1NCCO/C1=C/C=C\C |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-9-8(2)10-6-7-11-9/h3-5,10H,2,6-7H2,1H3/b4-3-,9-5+ |
| InChIKey | KTXXBVHTAUOQHX-XBURUKCPSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |