About 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine
2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine (PubChem CID 130340457) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine.
Analyze 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine?
The IUPAC name of 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine (CID 130340457) is 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine.
What is the SMILES notation for 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine?
The canonical SMILES for 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine is CC1CNC2=CCC=CC=C2O1.
What is the InChIKey of 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine?
The InChIKey is RTNKTIHYAKNURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8-7-11-9-5-3-2-4-6-10(9)12-8/h2,4-6,8,11H,3,7H2,1H3.
What are the key properties of 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine?
2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine has a molecular weight of 163.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3,4,6-tetrahydrocyclohepta[b][1,4]oxazine is sourced from PubChem (CID 130340457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).