C9H16N2O — CID 134406517
N-methyl-2-[(6-methyl-1,2-dihydropyridin-3-yl)oxy]ethanamine (PubChem CID 134406517) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methyl-2-[(6-methyl-1,2-dihydropyridin-3-yl)oxy]ethanamine.
| Compound Name | N-methyl-2-[(6-methyl-1,2-dihydropyridin-3-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 134406517 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-methyl-2-[(6-methyl-1,2-dihydropyridin-3-yl)oxy]ethanamine |
| SMILES | CNCCOC1=CC=C(C)NC1 |
| InChI | InChI=1S/C9H16N2O/c1-8-3-4-9(7-11-8)12-6-5-10-2/h3-4,10-11H,5-7H2,1-2H3 |
| InChIKey | AQIWJQZFGIPYDJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|