C12H24N2O — CID 134406227
(2Z,4E)-5-[1-(propylamino)propan-2-yloxy]hexa-2,4-dien-2-amine (PubChem CID 134406227) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (2Z,4E)-5-[1-(propylamino)propan-2-yloxy]hexa-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-5-[1-(propylamino)propan-2-yloxy]hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134406227 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2Z,4E)-5-[1-(propylamino)propan-2-yloxy]hexa-2,4-dien-2-amine |
| SMILES | CCCNCC(C)O/C(C)=C/C=C(/C)N |
| InChI | InChI=1S/C12H24N2O/c1-5-8-14-9-12(4)15-11(3)7-6-10(2)13/h6-7,12,14H,5,8-9,13H2,1-4H3/b10-6-,11-7+ |
| InChIKey | YYWWYHRTLYVUKJ-NAKBGQTNSA-N |
| XLogP | 2.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|