C10H18N2O — CID 122518402
(3Z,5E)-2-N-(2-methoxyethyl)hepta-1,3,5-triene-2,5-diamine (PubChem CID 122518402) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (3Z,5E)-2-N-(2-methoxyethyl)hepta-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z,5E)-2-N-(2-methoxyethyl)hepta-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 122518402 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3Z,5E)-2-N-(2-methoxyethyl)hepta-1,3,5-triene-2,5-diamine |
| SMILES | C=C(/C=C\C(N)=C/C)NCCOC |
| InChI | InChI=1S/C10H18N2O/c1-4-10(11)6-5-9(2)12-7-8-13-3/h4-6,12H,2,7-8,11H2,1,3H3/b6-5-,10-4+ |
| InChIKey | HAHRGONBOJHCRV-QYONPMAVSA-N |
| XLogP | 1.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|