C8H18N2O — CID 88690408
(E)-N'-(2-methoxyethyl)-N,N-dimethylprop-1-ene-1,3-diamine (PubChem CID 88690408) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is (E)-N'-(2-methoxyethyl)-N,N-dimethylprop-1-ene-1,3-diamine.
| Compound Name | (E)-N'-(2-methoxyethyl)-N,N-dimethylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 88690408 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (E)-N'-(2-methoxyethyl)-N,N-dimethylprop-1-ene-1,3-diamine |
| SMILES | COCCNC/C=C/N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-10(2)7-4-5-9-6-8-11-3/h4,7,9H,5-6,8H2,1-3H3/b7-4+ |
| InChIKey | AYULJOXAQGYEEO-QPJJXVBHSA-N |
| XLogP | 0.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|