C8H16N2O — CID 139390286
(2Z)-4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine (PubChem CID 139390286) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (2Z)-4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine.
| Compound Name | (2Z)-4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 139390286 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (2Z)-4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine |
| SMILES | C=C(/C=C\CN)NCCOC |
| InChI | InChI=1S/C8H16N2O/c1-8(4-3-5-9)10-6-7-11-2/h3-4,10H,1,5-7,9H2,2H3/b4-3- |
| InChIKey | ZNZGESUBIQFPCW-ARJAWSKDSA-N |
| XLogP | 0.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|