C10H17N3O — CID 88943444
(1E,3Z)-5-morpholin-4-ylhexa-1,3,5-triene-1,2-diamine (PubChem CID 88943444) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (1E,3Z)-5-morpholin-4-ylhexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1E,3Z)-5-morpholin-4-ylhexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 88943444 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (1E,3Z)-5-morpholin-4-ylhexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C(/C=C\C(N)=C/N)N1CCOCC1 |
| InChI | InChI=1S/C10H17N3O/c1-9(2-3-10(12)8-11)13-4-6-14-7-5-13/h2-3,8H,1,4-7,11-12H2/b3-2-,10-8+ |
| InChIKey | OMBPOFKYOARTAL-QQOOZTEWSA-N |
| XLogP | 0.15 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|