C10H15FN2O — CID 142898847
(3E)-4-fluoro-5-morpholin-4-ylhexa-1,3,5-trien-2-amine (PubChem CID 142898847) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is (3E)-4-fluoro-5-morpholin-4-ylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-fluoro-5-morpholin-4-ylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142898847 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (3E)-4-fluoro-5-morpholin-4-ylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(/F)C(=C)N1CCOCC1 |
| InChI | InChI=1S/C10H15FN2O/c1-8(12)7-10(11)9(2)13-3-5-14-6-4-13/h7H,1-6,12H2/b10-7+ |
| InChIKey | XVDHAOQIOBJJRO-JXMROGBWSA-N |
| XLogP | 1.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|