C9H14FNO — CID 143431081
4-[(3E)-3-fluoropenta-1,3-dien-2-yl]morpholine (PubChem CID 143431081) has the molecular formula C9H14FNO and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-[(3E)-3-fluoropenta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(3E)-3-fluoropenta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 143431081 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-[(3E)-3-fluoropenta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C(F)=C\C)N1CCOCC1 |
| InChI | InChI=1S/C9H14FNO/c1-3-9(10)8(2)11-4-6-12-7-5-11/h3H,2,4-7H2,1H3/b9-3+ |
| InChIKey | QCVCWUGPYMGUSK-YCRREMRBSA-N |
| XLogP | 1.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|