C11H17FN2O — CID 143062168
(2E,4E)-5-fluoro-6-morpholin-4-ylhepta-2,4,6-trien-3-amine (PubChem CID 143062168) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-6-morpholin-4-ylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-5-fluoro-6-morpholin-4-ylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143062168 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2E,4E)-5-fluoro-6-morpholin-4-ylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C(F)=C\C(N)=C/C)N1CCOCC1 |
| InChI | InChI=1S/C11H17FN2O/c1-3-10(13)8-11(12)9(2)14-4-6-15-7-5-14/h3,8H,2,4-7,13H2,1H3/b10-3+,11-8+ |
| InChIKey | KTDUDAOACFSZOI-BPWDCMFVSA-N |
| XLogP | 1.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|