C12H20FNO — CID 143588785
(3Z,5Z)-N-(2-ethoxyethyl)-3-fluoro-N-methylhepta-1,3,5-trien-4-amine (PubChem CID 143588785) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is (3Z,5Z)-N-(2-ethoxyethyl)-3-fluoro-N-methylhepta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5Z)-N-(2-ethoxyethyl)-3-fluoro-N-methylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143588785 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (3Z,5Z)-N-(2-ethoxyethyl)-3-fluoro-N-methylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(F)=C(\C=C/C)N(C)CCOCC |
| InChI | InChI=1S/C12H20FNO/c1-5-8-12(11(13)6-2)14(4)9-10-15-7-3/h5-6,8H,2,7,9-10H2,1,3-4H3/b8-5-,12-11- |
| InChIKey | PNNVBAHSSVXRFB-RVLDWYSYSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|