C12H21NO2 — CID 123221093
N,N-bis(2-methoxyethyl)hexa-2,4,5-trien-3-amine (PubChem CID 123221093) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)hexa-2,4,5-trien-3-amine.
| Compound Name | N,N-bis(2-methoxyethyl)hexa-2,4,5-trien-3-amine |
|---|---|
| PubChem CID | 123221093 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N,N-bis(2-methoxyethyl)hexa-2,4,5-trien-3-amine |
| SMILES | C=C=CC(=CC)N(CCOC)CCOC |
| InChI | InChI=1S/C12H21NO2/c1-5-7-12(6-2)13(8-10-14-3)9-11-15-4/h6-7H,1,8-11H2,2-4H3 |
| InChIKey | NVICDJNIGBNEQH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|